Products 95163-43-2
CAS 95163-43-2 appears in our catalog under these names: 1-Trityl-1h-pyrazole, 95%, 1-Trityl-1H-pyrazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-tritylpyrazole (CAS 95163-43-2) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 1-tritylpyrazole. InChIKey: DZMNGSPDNIVJMT-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1-tritylpyrazole |
| InChIKey | DZMNGSPDNIVJMT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=CC=N4 |
Computed by PubChem (NCBI)