CAS 2747913-95-5 is the registry number for (±)-Bifonazole-d5. Offered by: TRC. Available pack sizes: 50mg.
1-[(2,3,4,5,6-pentadeuteriophenyl)-(4-phenylphenyl)methyl]imidazole (CAS 2747913-95-5) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 315.4 g/mol. IUPAC name: 1-[(2,3,4,5,6-pentadeuteriophenyl)-(4-phenylphenyl)methyl]imidazole. InChIKey: OCAPBUJLXMYKEJ-OUHXUHDZSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-[(2,3,4,5,6-pentadeuteriophenyl)-(4-phenylphenyl)methyl]imidazole |
| InChIKey | OCAPBUJLXMYKEJ-OUHXUHDZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=CC=C(C=C2)C3=CC=CC=C3)N4C=CN=C4)[2H])[2H] |
Computed by PubChem (NCBI)