Products 7346-22-7

CAS 7346-22-7 is the registry number for 1-(4-Chlorobenzyl)-4,5-diphenyl-1H-imidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

1-benzyl-4,5-diphenylimidazole (CAS 7346-22-7) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 1-benzyl-4,5-diphenylimidazole. InChIKey: KUROZJDKGKYWIG-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18N2
Molecular weight310.4 g/mol
IUPAC name1-benzyl-4,5-diphenylimidazole
InChIKeyKUROZJDKGKYWIG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CN2C=NC(=C2C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)