CAS 7346-22-7 is the registry number for 1-(4-Chlorobenzyl)-4,5-diphenyl-1H-imidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
1-benzyl-4,5-diphenylimidazole (CAS 7346-22-7) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 1-benzyl-4,5-diphenylimidazole. InChIKey: KUROZJDKGKYWIG-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 1-benzyl-4,5-diphenylimidazole |
| InChIKey | KUROZJDKGKYWIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC(=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)