CAS 13362-56-6 is the registry number for 6,7-Dimethyl-2,3-diphenylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g.
6,7-dimethyl-2,3-diphenylquinoxaline (CAS 13362-56-6) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 6,7-dimethyl-2,3-diphenylquinoxaline. InChIKey: IEAJHLSDPVLRQQ-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 6,7-dimethyl-2,3-diphenylquinoxaline |
| InChIKey | IEAJHLSDPVLRQQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(C(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)