Products 13362-56-6

CAS 13362-56-6 is the registry number for 6,7-Dimethyl-2,3-diphenylquinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g.

Structural formula: {0} (CAS {1})

6,7-dimethyl-2,3-diphenylquinoxaline (CAS 13362-56-6) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 6,7-dimethyl-2,3-diphenylquinoxaline. InChIKey: IEAJHLSDPVLRQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18N2
Molecular weight310.4 g/mol
IUPAC name6,7-dimethyl-2,3-diphenylquinoxaline
InChIKeyIEAJHLSDPVLRQQ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)N=C(C(=N2)C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)