Products 3719-84-4
CAS 3719-84-4 is the registry number for 2,3-Bis(4-methylphenyl)quinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
2,3-bis(4-methylphenyl)quinoxaline (CAS 3719-84-4) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 2,3-bis(4-methylphenyl)quinoxaline. InChIKey: CADAMBSHNNZLNB-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2,3-bis(4-methylphenyl)quinoxaline |
| InChIKey | CADAMBSHNNZLNB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3N=C2C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)