Products 1145-01-3
CAS 1145-01-3 appears in our catalog under these names: 3,5-Diphenylpyrazole, 3,5–Diphenylpyrazole, 3,5-Diphenylpyrazole, >98.0%(GC), 3,5-Diphenylpyrazole, 99%, 3,5-DIPHENYLPYRAZOLE, 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g.
3,5-diphenyl-1H-pyrazole (CAS 1145-01-3) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 3,5-diphenyl-1H-pyrazole. InChIKey: JXHKUYQCEJILEI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 3,5-diphenyl-1H-pyrazole |
| InChIKey | JXHKUYQCEJILEI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NN2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)