CAS 1146-84-5 appears in our catalog under these names: 2,4,4',6-Tetramethylbenzophenone, 95%, 2,4,4',6-Tetramethylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 25mg, 10mg, 50mg.
(4-methylphenyl)-(2,4,6-trimethylphenyl)methanone (CAS 1146-84-5) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: (4-methylphenyl)-(2,4,6-trimethylphenyl)methanone. InChIKey: NYAJIOBEMYMSAE-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | (4-methylphenyl)-(2,4,6-trimethylphenyl)methanone |
| InChIKey | NYAJIOBEMYMSAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2C)C)C |
Computed by PubChem (NCBI)