CAS 4659-48-7 is the registry number for Bis(3,4–dimethylphenyl)methanone. Offered by: GLPBio. Available pack sizes: 1g.
Bis(3,4-dimethylphenyl)methanone (CAS 4659-48-7) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: bis(3,4-dimethylphenyl)methanone. InChIKey: FKFVCCPWFITRSN-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | bis(3,4-dimethylphenyl)methanone |
| InChIKey | FKFVCCPWFITRSN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)