CAS 22682-43-5 appears in our catalog under these names: 2,2',4,6'-Tetramethylbenzophenone, 95%, 2,2',4,6'-Tetramethylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg.
(2,4-dimethylphenyl)-(2,6-dimethylphenyl)methanone (CAS 22682-43-5) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: (2,4-dimethylphenyl)-(2,6-dimethylphenyl)methanone. InChIKey: DWQJBVNSJDHLCP-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | (2,4-dimethylphenyl)-(2,6-dimethylphenyl)methanone |
| InChIKey | DWQJBVNSJDHLCP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2=C(C=CC=C2C)C)C |
Computed by PubChem (NCBI)