CAS 14252-21-2 appears in our catalog under these names: 2,2',6,6'-Tetramethylbenzophenone, 95%, 2,2',6,6'-Tetramethylbenzophenone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 50mg.
Bis(2,6-dimethylphenyl)methanone (CAS 14252-21-2) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: bis(2,6-dimethylphenyl)methanone. InChIKey: ITIDCQRFFRKNNH-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | bis(2,6-dimethylphenyl)methanone |
| InChIKey | ITIDCQRFFRKNNH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(=O)C2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)