CAS 343604-06-8 is the registry number for 4'-(tert-Butyl)-[1,1'-biphenyl]-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-tert-butylphenyl)benzaldehyde (CAS 343604-06-8) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: 3-(4-tert-butylphenyl)benzaldehyde. InChIKey: LGCFXYBKJMFGJC-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)benzaldehyde |
| InChIKey | LGCFXYBKJMFGJC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=CC(=C2)C=O |
Computed by PubChem (NCBI)