CAS 3478-88-4 appears in our catalog under these names: 2,2',4,4'-Tetramethylbenzophenone, 95%, 2,2',4,4'–Tetramethylbenzophenone, 2,2',4,4'-Tetramethylbenzophenone, 2,2',4,4'-Tetramethylbenzophenone, >96.0%(GC), Bis(2,4-dimethylphenyl)methanone 96%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 2g, 10g, 250mg.
Bis(2,4-dimethylphenyl)methanone (CAS 3478-88-4) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: bis(2,4-dimethylphenyl)methanone. InChIKey: KFNQSAKXSGGDAA-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | bis(2,4-dimethylphenyl)methanone |
| InChIKey | KFNQSAKXSGGDAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C2=C(C=C(C=C2)C)C)C |
Computed by PubChem (NCBI)