CAS 1210054-82-2 is the registry number for 4-(2,4,6-Trimethylbenzyl)benzaldehyde, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
4-[(2,4,6-trimethylphenyl)methyl]benzaldehyde (CAS 1210054-82-2) is a chemical compound with the molecular formula C17H18O and a molecular weight of 238.32 g/mol. IUPAC name: 4-[(2,4,6-trimethylphenyl)methyl]benzaldehyde. InChIKey: PZKOFXHSKYTLCX-UHFFFAOYSA-N.
| Molecular formula | C17H18O |
|---|---|
| Molecular weight | 238.32 g/mol |
| IUPAC name | 4-[(2,4,6-trimethylphenyl)methyl]benzaldehyde |
| InChIKey | PZKOFXHSKYTLCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC2=CC=C(C=C2)C=O)C |
Computed by PubChem (NCBI)