CAS 1146290-20-1 is the registry number for 6-Ethoxy-2,3-dihydro-1H-indole-2,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-ethoxy-1H-indole-2,3-dione (CAS 1146290-20-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6-ethoxy-1H-indole-2,3-dione. InChIKey: REGUKPZQIPNZGM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6-ethoxy-1H-indole-2,3-dione |
| InChIKey | REGUKPZQIPNZGM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C(=O)C(=O)N2 |
Computed by PubChem (NCBI)