CAS 1147-65-5 appears in our catalog under these names: (2-Carboxyphenyl)iminodiacetic acid, 95%, 2,2'-((2-Carboxyphenyl)azanediyl)diacetic acid, 95%, (2–Carboxyphenyl)iminodiacetic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
2-[bis(carboxymethyl)amino]benzoic acid (CAS 1147-65-5) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 2-[bis(carboxymethyl)amino]benzoic acid. InChIKey: IKEUZCGOPYSHNN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 2-[bis(carboxymethyl)amino]benzoic acid |
| InChIKey | IKEUZCGOPYSHNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)