Products 92289-14-0
CAS 92289-14-0 appears in our catalog under these names: 3-(4-Nitrophenyl)pentanedioic acid, 95%, 3–(4–Nitrophenyl)pentanedioic acid, 3-(4-Nitrophenyl)pentanedioic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 25g, 1g, 100mg, 250mg.
3-(4-nitrophenyl)pentanedioic acid (CAS 92289-14-0) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 3-(4-nitrophenyl)pentanedioic acid. InChIKey: YNPLFNKGJKRZNX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 3-(4-nitrophenyl)pentanedioic acid |
| InChIKey | YNPLFNKGJKRZNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(=O)O)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)