CAS 2888554-10-5 is the registry number for Ethyl 4-hydroxy-7-nitro-2,3-dihydrobenzofuran-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 4-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-6-carboxylate (CAS 2888554-10-5) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: ethyl 4-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-6-carboxylate. InChIKey: LQCQWKGLZUVRBN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | ethyl 4-hydroxy-7-nitro-2,3-dihydro-1-benzofuran-6-carboxylate |
| InChIKey | LQCQWKGLZUVRBN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C2CCOC2=C1[N+](=O)[O-])O |
Computed by PubChem (NCBI)