CAS 20567-38-8 appears in our catalog under these names: 4,5-Dimethoxy-2-nitrocinnamic acid, 98%, 3,4-Dimethoxy-6-nitrocinnamic acid/ 98%, 4,5-Dimethoxy-2-nitrocinnamic acid, 3-(4,5-Dimethoxy-2-nitrophenyl)acrylic acid 98% (E), 3-(4,5-Dimethoxy-2-nitrophenyl)acrylic acid, 98% (E), 98% (E). Offered by: Combi-blocks, Chemat, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250g, 100g.
(E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid (CAS 20567-38-8) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: (E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid. InChIKey: BZIRMMAJZSOLEW-ONEGZZNKSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | (E)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoic acid |
| InChIKey | BZIRMMAJZSOLEW-ONEGZZNKSA-N |
| SMILES | COC1=C(C=C(C(=C1)/C=C/C(=O)O)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)