CAS 2929-91-1 appears in our catalog under these names: P-Nitrobenzal diacetate, 95%, 4-Nitrobenzaldiacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 50g.
[acetyloxy-(4-nitrophenyl)methyl] acetate (CAS 2929-91-1) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: [acetyloxy-(4-nitrophenyl)methyl] acetate. InChIKey: WGESNIARHZFDHQ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | [acetyloxy-(4-nitrophenyl)methyl] acetate |
| InChIKey | WGESNIARHZFDHQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=C(C=C1)[N+](=O)[O-])OC(=O)C |
Computed by PubChem (NCBI)