CAS 6345-63-7 appears in our catalog under these names: O-Nitrobenzal diacetate, 95%, 2-Nitrobenzaldiacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2g.
[acetyloxy-(2-nitrophenyl)methyl] acetate (CAS 6345-63-7) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: [acetyloxy-(2-nitrophenyl)methyl] acetate. InChIKey: PMZHONATLZBKIL-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | [acetyloxy-(2-nitrophenyl)methyl] acetate |
| InChIKey | PMZHONATLZBKIL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=CC=C1[N+](=O)[O-])OC(=O)C |
Computed by PubChem (NCBI)