Products 86364-45-6

CAS 86364-45-6 is the registry number for 2,2'-((4-Carboxyphenyl)azanediyl)diacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[bis(carboxymethyl)amino]benzoic acid (CAS 86364-45-6) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 4-[bis(carboxymethyl)amino]benzoic acid. InChIKey: ASLSBECRIAGZBX-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO6
Molecular weight253.21 g/mol
IUPAC name4-[bis(carboxymethyl)amino]benzoic acid
InChIKeyASLSBECRIAGZBX-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)N(CC(=O)O)CC(=O)O

Computed by PubChem (NCBI)