CAS 86364-45-6 is the registry number for 2,2'-((4-Carboxyphenyl)azanediyl)diacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[bis(carboxymethyl)amino]benzoic acid (CAS 86364-45-6) is a chemical compound with the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. IUPAC name: 4-[bis(carboxymethyl)amino]benzoic acid. InChIKey: ASLSBECRIAGZBX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO6 |
|---|---|
| Molecular weight | 253.21 g/mol |
| IUPAC name | 4-[bis(carboxymethyl)amino]benzoic acid |
| InChIKey | ASLSBECRIAGZBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)