Products 114718-44-4
CAS 114718-44-4 is the registry number for 2,3,4-Tri-O-acetyl-L-fucal. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.
[(2S,3R,4R)-4,5-diacetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate (CAS 114718-44-4) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: [(2S,3R,4R)-4,5-diacetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate. InChIKey: GUXRKCIUZAPROT-GHGOGRRBSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [(2S,3R,4R)-4,5-diacetyloxy-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate |
| InChIKey | GUXRKCIUZAPROT-GHGOGRRBSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C(=CO1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)