CAS 63640-41-5 appears in our catalog under these names: Tri-o-acetyl-l-glucal, 95%, 3,4,6-Tri-O-acetyl-L-glucal. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 500mg, 1000mg, 5000mg, 2000mg.
[(2S,3R,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 63640-41-5) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: [(2S,3R,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: LLPWGHLVUPBSLP-SDDRHHMPSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [(2S,3R,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | LLPWGHLVUPBSLP-SDDRHHMPSA-N |
| SMILES | CC(=O)OC[C@H]1[C@@H]([C@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)