CAS 2873-29-2 appears in our catalog under these names: Tri-O-acetyl-D-glucal, 3,4,6-Tri-O-acetyl-D-glucal, 98% , Tri-O-acetyl-D-glucal, 98.00%, 3,4,6-Tri-O-acetyl-D-glucal, Tri-O-acetyl-D-glucal, >96.0%(GC). Offered by: TRC, Mikromol, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 25g, 50g, 5g, 25mg, 100g, 500g, 250g, 1000g.
[(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 2873-29-2) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: [(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: LLPWGHLVUPBSLP-UTUOFQBUSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | LLPWGHLVUPBSLP-UTUOFQBUSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)