Products 478529-37-2
CAS 478529-37-2 is the registry number for Tri-O-acetyl-D-glucal-13C-2. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
[(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl](113C)methyl acetate (CAS 478529-37-2) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 273.24 g/mol. IUPAC name: [(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl](113C)methyl acetate. InChIKey: LLPWGHLVUPBSLP-UVCKGYJCSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl](113C)methyl acetate |
| InChIKey | LLPWGHLVUPBSLP-UVCKGYJCSA-N |
| SMILES | CC(=O)O[13CH2][C@@H]1[C@H]([C@@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)