CAS 2400-71-7 appears in our catalog under these names: o–Hydroxyphenyl β–D–glucoside, Pyrocatechol monoglucoside/ 98%, Pyrocatechol monoglucoside, Pyrocatechol monoglucoside, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 1 mg.
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxyphenoxy)oxane-3,4,5-triol (CAS 2400-71-7) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxyphenoxy)oxane-3,4,5-triol. InChIKey: NMZWIAATAZXMRV-RMPHRYRLSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(2-hydroxyphenoxy)oxane-3,4,5-triol |
| InChIKey | NMZWIAATAZXMRV-RMPHRYRLSA-N |
| SMILES | C1=CC=C(C(=C1)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Computed by PubChem (NCBI)