Products 860035-18-3
CAS 860035-18-3 is the registry number for (3S,4S)-2,5-Dioxotetrahydrofuran-3,4-diyl bis(2-methylpropanoate), 95%. Offered by: Ambeed. Available pack sizes: 5g, 25g, 100g.
[(3S,4S)-4-(2-methylpropanoyloxy)-2,5-dioxooxolan-3-yl] 2-methylpropanoate (CAS 860035-18-3) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: [(3S,4S)-4-(2-methylpropanoyloxy)-2,5-dioxooxolan-3-yl] 2-methylpropanoate. InChIKey: MIHNOAOFBIUIDW-YUMQZZPRSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [(3S,4S)-4-(2-methylpropanoyloxy)-2,5-dioxooxolan-3-yl] 2-methylpropanoate |
| InChIKey | MIHNOAOFBIUIDW-YUMQZZPRSA-N |
| SMILES | CC(C)C(=O)O[C@H]1[C@@H](C(=O)OC1=O)OC(=O)C(C)C |
Computed by PubChem (NCBI)