CAS 52485-06-0 is the registry number for (2R,3S,4S)-2-(Acetoxymethyl)-3,4-dihydro-2H-pyran-3,4-diyl diacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate (CAS 52485-06-0) is a chemical compound with the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. IUPAC name: [(2R,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate. InChIKey: LLPWGHLVUPBSLP-TUAOUCFPSA-N.
| Molecular formula | C12H16O7 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | [(2R,3S,4S)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| InChIKey | LLPWGHLVUPBSLP-TUAOUCFPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H](C=CO1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)