CAS 1147233-38-2 is the registry number for 5-Aminoisophthalamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-aminobenzene-1,3-dicarboxamide;hydrochloride (CAS 1147233-38-2) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: 5-aminobenzene-1,3-dicarboxamide;hydrochloride. InChIKey: FLWLBAUTYWIDSP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 5-aminobenzene-1,3-dicarboxamide;hydrochloride |
| InChIKey | FLWLBAUTYWIDSP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)N)N)C(=O)N.Cl |
Computed by PubChem (NCBI)