CAS 27080-50-8 appears in our catalog under these names: N-(2-Chloro-4-nitrophenyl)ethane-1,2-diamine, 95%, N1-(2-Chloro-4-nitrophenyl)ethane-1,2-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine (CAS 27080-50-8) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine. InChIKey: RDPNPSAGQXSAAH-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | N'-(2-chloro-4-nitrophenyl)ethane-1,2-diamine |
| InChIKey | RDPNPSAGQXSAAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NCCN |
Computed by PubChem (NCBI)