CAS 1435804-70-8 is the registry number for 2-(3-(Furan-2-yl)-1,2,4-oxadiazol-5-yl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride (CAS 1435804-70-8) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: 2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride. InChIKey: LAQFJGOVMNRILP-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 2-[3-(furan-2-yl)-1,2,4-oxadiazol-5-yl]ethanamine;hydrochloride |
| InChIKey | LAQFJGOVMNRILP-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NOC(=N2)CCN.Cl |
Computed by PubChem (NCBI)