CAS 70227-50-8 appears in our catalog under these names: 2-tert-Butyl-4-chloro-5-nitropyrimidine, 95%, 2–(tert–Butyl)–4–chloro–5–nitropyrimidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-tert-butyl-4-chloro-5-nitropyrimidine (CAS 70227-50-8) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: 2-tert-butyl-4-chloro-5-nitropyrimidine. InChIKey: WRWLLLIIGUUHCE-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 2-tert-butyl-4-chloro-5-nitropyrimidine |
| InChIKey | WRWLLLIIGUUHCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC=C(C(=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)