CAS 1354542-05-4 appears in our catalog under these names: 3-Nitro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride, 95%, 3-Nitro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride, 97%, 3–Nitro–5,6,7,8–tetrahydro–1,6–naphthyridine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
3-nitro-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride (CAS 1354542-05-4) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: 3-nitro-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride. InChIKey: LIFQMEDMAHFVBF-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | 3-nitro-5,6,7,8-tetrahydro-1,6-naphthyridine;hydrochloride |
| InChIKey | LIFQMEDMAHFVBF-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1N=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)