Products 39695-96-0
CAS 39695-96-0 is the registry number for 2-(4-nitrophenyl)ethanimidamide hydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 2g.
[1-amino-2-(4-nitrophenyl)ethylidene]azanium chloride (CAS 39695-96-0) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. IUPAC name: [1-amino-2-(4-nitrophenyl)ethylidene]azanium chloride. InChIKey: UWOXNCVLVJFRHA-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O2 |
|---|---|
| Molecular weight | 215.64 g/mol |
| IUPAC name | [1-amino-2-(4-nitrophenyl)ethylidene]azanium chloride |
| InChIKey | UWOXNCVLVJFRHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=[NH2+])N)[N+](=O)[O-].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
(4-Nitrophenyl)ethanimidamide--hydrogen chloride (1/1), p-Nitrophenylacetamidine hydrochloride, [1-amino-2-(4-nitrophenyl)ethylidene]azanium;chloride, 4-Nitrobenzeneethanimidamide monohydrochloride, Benzeneethanimidamide, 4-nitro-, monohydrochloride, ACETAMIDINE, 2-(p-NITROPHENYL)-, HYDROCHLORIDE