Products 1203588-99-1

CAS 1203588-99-1 is the registry number for 4-Guanidinobenzoic Acid-D4 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.

Structural formula: {0} (CAS {1})

2,3,5,6-tetradeuterio-4-(diaminomethylideneamino)benzoic acid;hydrochloride (CAS 1203588-99-1) is a chemical compound with the molecular formula C8H10ClN3O2 and a molecular weight of 219.66 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(diaminomethylideneamino)benzoic acid;hydrochloride. InChIKey: YETFLAUJROGBMC-FOMJDCLLSA-N.

Identity
Molecular formulaC8H10ClN3O2
Molecular weight219.66 g/mol
IUPAC name2,3,5,6-tetradeuterio-4-(diaminomethylideneamino)benzoic acid;hydrochloride
InChIKeyYETFLAUJROGBMC-FOMJDCLLSA-N
SMILES[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])N=C(N)N)[2H].Cl

Computed by PubChem (NCBI)