Products 114973-22-7
CAS 114973-22-7 appears in our catalog under these names: 2,5–Difluoro–4–(trifluoromethyl)aniline, 4-Amino-2,5-difluorobenzotrifluoride, 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 5g.
2,5-difluoro-4-(trifluoromethyl)aniline (CAS 114973-22-7) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 2,5-difluoro-4-(trifluoromethyl)aniline. InChIKey: FPEXXFHBKBTGJL-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 2,5-difluoro-4-(trifluoromethyl)aniline |
| InChIKey | FPEXXFHBKBTGJL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)N)F)C(F)(F)F |
Computed by PubChem (NCBI)