Products 124185-34-8
CAS 124185-34-8 appears in our catalog under these names: 2,3-Difluoro-6-(trifluoromethyl)aniline, 95%, 2,3-Difluoro-6-(trifluoromethyl)aniline, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm. Available pack sizes: 5g, 1g, 250mg.
2,3-difluoro-6-(trifluoromethyl)aniline (CAS 124185-34-8) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 2,3-difluoro-6-(trifluoromethyl)aniline. InChIKey: JRUZXPMLPYDZBR-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 2,3-difluoro-6-(trifluoromethyl)aniline |
| InChIKey | JRUZXPMLPYDZBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)N)F)F |
Computed by PubChem (NCBI)