Products 123973-26-2
CAS 123973-26-2 appears in our catalog under these names: 2,4-Difluoro-3-(trifluoromethyl)aniline, 95%, 2,4-Difluoro-3-(trifluoromethyl)aniline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,4-difluoro-3-(trifluoromethyl)aniline (CAS 123973-26-2) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 2,4-difluoro-3-(trifluoromethyl)aniline. InChIKey: HSEHIYFOQRINOP-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 2,4-difluoro-3-(trifluoromethyl)aniline |
| InChIKey | HSEHIYFOQRINOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)F)C(F)(F)F)F |
Computed by PubChem (NCBI)