CAS 123950-46-9 appears in our catalog under these names: 4-Amino-2,3-difluorobenzotrifluoride, 95%, 2,3-Difluoro-4-(trifluoromethyl)aniline 95%, 4-Amino-2,3-difluorobenzotrifluoride, 2,3-Difluoro-4-(trifluoromethyl)aniline, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
2,3-difluoro-4-(trifluoromethyl)aniline (CAS 123950-46-9) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 2,3-difluoro-4-(trifluoromethyl)aniline. InChIKey: RRTVKWPCWJVMGM-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 2,3-difluoro-4-(trifluoromethyl)aniline |
| InChIKey | RRTVKWPCWJVMGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)F)F)N |
Computed by PubChem (NCBI)