CAS 1262197-39-6 is the registry number for 4,5-Difluoro-2-(trifluoromethyl)aniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4,5-difluoro-2-(trifluoromethyl)aniline (CAS 1262197-39-6) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 4,5-difluoro-2-(trifluoromethyl)aniline. InChIKey: VMBANTPGXUQMLI-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 4,5-difluoro-2-(trifluoromethyl)aniline |
| InChIKey | VMBANTPGXUQMLI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)N)C(F)(F)F |
Computed by PubChem (NCBI)