Products 1803732-04-8
CAS 1803732-04-8 is the registry number for 3,6-Difluoro-2-(trifluoromethyl)-benzenamine. Offered by: TRC. Available pack sizes: 100mg.
3,6-difluoro-2-(trifluoromethyl)aniline (CAS 1803732-04-8) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 3,6-difluoro-2-(trifluoromethyl)aniline. InChIKey: MSRFRWLBWPYYSQ-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 3,6-difluoro-2-(trifluoromethyl)aniline |
| InChIKey | MSRFRWLBWPYYSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(F)(F)F)N)F |
Computed by PubChem (NCBI)