CAS 261944-56-3 appears in our catalog under these names: 2,4–Difluoro–5–(trifluoromethyl)aniline, 2,4-Difluoro-5-(trifluoromethyl)aniline, 98%, 98%, 2,4-Difluoro-5-(trifluoromethyl)aniline, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
2,4-difluoro-5-(trifluoromethyl)aniline (CAS 261944-56-3) is a chemical compound with the molecular formula C7H4F5N and a molecular weight of 197.10 g/mol. IUPAC name: 2,4-difluoro-5-(trifluoromethyl)aniline. InChIKey: FFQALBCXGPYQGT-UHFFFAOYSA-N.
| Molecular formula | C7H4F5N |
|---|---|
| Molecular weight | 197.10 g/mol |
| IUPAC name | 2,4-difluoro-5-(trifluoromethyl)aniline |
| InChIKey | FFQALBCXGPYQGT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)F)F)C(F)(F)F |
Computed by PubChem (NCBI)