Products 115122-79-7
CAS 115122-79-7 is the registry number for 2-Oxo-2,5,6,7-tetrahydro-1H-cyclopenta[b]pyridine-4-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-4-carboxylic acid (CAS 115122-79-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-4-carboxylic acid. InChIKey: VJWZPFRDVGCOOZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-4-carboxylic acid |
| InChIKey | VJWZPFRDVGCOOZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)NC(=O)C=C2C(=O)O |
Computed by PubChem (NCBI)