CAS 115210-54-3 appears in our catalog under these names: 2-Methyl-5-nitroindoline, 95%, 2,3-Dihydro-2-methyl-5-nitro-1H-indole, 98%, 98%, 2-methyl-5-nitroindoline, 98%(HPLC),RG. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
2-methyl-5-nitro-2,3-dihydro-1H-indole (CAS 115210-54-3) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-methyl-5-nitro-2,3-dihydro-1H-indole. InChIKey: JVOZJSSFSXFDAU-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-methyl-5-nitro-2,3-dihydro-1H-indole |
| InChIKey | JVOZJSSFSXFDAU-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(N1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)