CAS 115234-25-8 appears in our catalog under these names: Eugenol Impurity 25, 4-(2-Propen-1-yl)-1,2-benzenediol 1-Methanesulfonate. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(2-hydroxy-4-prop-2-enylphenyl) methanesulfonate (CAS 115234-25-8) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: (2-hydroxy-4-prop-2-enylphenyl) methanesulfonate. InChIKey: DGBFOOSPOYZMIZ-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | (2-hydroxy-4-prop-2-enylphenyl) methanesulfonate |
| InChIKey | DGBFOOSPOYZMIZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=C(C=C(C=C1)CC=C)O |
Computed by PubChem (NCBI)