CAS 960535-44-8 appears in our catalog under these names: 6-Bromo-2-chlorothiazolo(4,5-b)pyridine, 95%, 6-Bromo-2-chloro-(1,3)thiazolo(4,5-b)pyridine, 6-BROMO-2-CHLOROTHIAZOLO[4,5-B]PYRIDINE, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine (CAS 960535-44-8) is a chemical compound with the molecular formula C6H2BrClN2S and a molecular weight of 249.52 g/mol. IUPAC name: 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine. InChIKey: QKBMJZODSYDEFC-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClN2S |
|---|---|
| Molecular weight | 249.52 g/mol |
| IUPAC name | 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | QKBMJZODSYDEFC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1SC(=N2)Cl)Br |
Computed by PubChem (NCBI)