Products 1152534-49-0
CAS 1152534-49-0 is the registry number for 1-(1,3-Dioxaindan-5-yl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,3-benzodioxol-5-yl)pyrazole-3-carboxylic acid (CAS 1152534-49-0) is a chemical compound with the molecular formula C11H8N2O4 and a molecular weight of 232.19 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)pyrazole-3-carboxylic acid. InChIKey: PGMYTTOFNMTJKT-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O4 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)pyrazole-3-carboxylic acid |
| InChIKey | PGMYTTOFNMTJKT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)N3C=CC(=N3)C(=O)O |
Computed by PubChem (NCBI)