CAS 115309-57-4 appears in our catalog under these names: tert–Butyl 6–chloronicotinate, tert-Butyl 6-chloronicotinate, tert-Butyl 6-chloronicotinate 95%, Tert-butyl 6-chloronicotinate, 95%, 95%, tert-Butyl 6-chloronicotinate, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100g, 250mg, 25g, 2.5g.
Tert-butyl 6-chloropyridine-3-carboxylate (CAS 115309-57-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: tert-butyl 6-chloropyridine-3-carboxylate. InChIKey: OFRLMTIBUAXBGV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | tert-butyl 6-chloropyridine-3-carboxylate |
| InChIKey | OFRLMTIBUAXBGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)