Products 1153165-78-6
CAS 1153165-78-6 appears in our catalog under these names: 3,5-Dichloro-2-(difluoromethoxy)benzaldehyde, 95%, 3,5-Dichloro-2-(difluoromethoxy)benzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3,5-dichloro-2-(difluoromethoxy)benzaldehyde (CAS 1153165-78-6) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 3,5-dichloro-2-(difluoromethoxy)benzaldehyde. InChIKey: YCQQNUKUULYBSX-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F2O2 |
|---|---|
| Molecular weight | 241.02 g/mol |
| IUPAC name | 3,5-dichloro-2-(difluoromethoxy)benzaldehyde |
| InChIKey | YCQQNUKUULYBSX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)OC(F)F)Cl)Cl |
Computed by PubChem (NCBI)