Products 2648588-78-5

CAS 2648588-78-5 is the registry number for 3-Chloro-5-(chlorodifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-chloro-5-[chloro(difluoro)methyl]benzoic acid (CAS 2648588-78-5) is a chemical compound with the molecular formula C8H4Cl2F2O2 and a molecular weight of 241.02 g/mol. IUPAC name: 3-chloro-5-[chloro(difluoro)methyl]benzoic acid. InChIKey: QZOGXGRRSIZXHR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4Cl2F2O2
Molecular weight241.02 g/mol
IUPAC name3-chloro-5-[chloro(difluoro)methyl]benzoic acid
InChIKeyQZOGXGRRSIZXHR-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(F)(F)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)